adenosine 5'-monophosphate 2',3'-dialdehyde structure
|
Common Name | adenosine 5'-monophosphate 2',3'-dialdehyde | ||
|---|---|---|---|---|
| CAS Number | 13011-02-4 | Molecular Weight | 345.20500 | |
| Density | 1.93g/cm3 | Boiling Point | 654.4ºC at 760mmHg | |
| Molecular Formula | C10H12N5O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349.6ºC | |
| Name | [(2R)-2-[(1R)-1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-oxopropyl] dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.93g/cm3 |
|---|---|
| Boiling Point | 654.4ºC at 760mmHg |
| Molecular Formula | C10H12N5O7P |
| Molecular Weight | 345.20500 |
| Flash Point | 349.6ºC |
| Exact Mass | 345.04700 |
| PSA | 189.56000 |
| Vapour Pressure | 5.09E-18mmHg at 25°C |
| Index of Refraction | 1.748 |
| InChIKey | MEHSJNLHNAMNGO-NKWVEPMBSA-N |
| SMILES | Nc1ncnc2c1ncn2C(C=O)OC(C=O)COP(=O)(O)O |
| HS Code | 2933990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| periodate-oxidized AMP |
| 2',3'-Dialdehyde AMP |
| Dial-amp |
| Adenosine 5'-monophosphate 2',3'-dialdehyde |