2',3'-dialdehyde ATP structure
|
Common Name | 2',3'-dialdehyde ATP | ||
|---|---|---|---|---|
| CAS Number | 54970-91-1 | Molecular Weight | 505.16500 | |
| Density | 2.28g/cm3 | Boiling Point | 827.4ºC at 760 mmHg | |
| Molecular Formula | C10H14N5O13P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 454.2ºC | |
| Name | [[(2R)-2-[(1R)-1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.28g/cm3 |
|---|---|
| Boiling Point | 827.4ºC at 760 mmHg |
| Molecular Formula | C10H14N5O13P3 |
| Molecular Weight | 505.16500 |
| Flash Point | 454.2ºC |
| Exact Mass | 504.98000 |
| PSA | 302.24000 |
| Index of Refraction | 1.776 |
| InChIKey | ZOSTZYMLOPBGQI-NKWVEPMBSA-N |
| SMILES | Nc1ncnc2c1ncn2C(C=O)OC(C=O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| HS Code | 2933990090 |
|---|
|
~%
2',3'-dialdehyde ATP CAS#:54970-91-1 |
| Literature: Guo, Wei; Azhar, M. Ameruddin; Xu, Yuhong; Wright, Michael; Kamal, Ahmed; Miller, Andrew D. Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 23 p. 7175 - 7179 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| oATP |
| periodate oxidized ATP |
| Adenosine 5'-triphosphate 2',3',-dialdehyde |
| Oxo-ATP |
| 2',3'-dialdehyde ATP |
| Dial-ATP |
| ATP Dialdehyde |
| Oxidized ATP |
| Oxidised ATP |