1-[2-Amino-1-(4-methoxyphenyl)-ethyl]-cyclohexanol hydrochloride structure
|
Common Name | 1-[2-Amino-1-(4-methoxyphenyl)-ethyl]-cyclohexanol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 130198-05-9 | Molecular Weight | 285.810 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24ClNO2 | Melting Point | 172-180℃ | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-Amino-1-(4-methoxyphenyl)ethyl]cyclohexanol Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 172-180℃ |
|---|---|
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.810 |
| Exact Mass | 285.149567 |
| PSA | 55.48000 |
| LogP | 3.93500 |
| InChIKey | NTKXIDDUCSFBBF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(CN)C2(O)CCCCC2)cc1.Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
|
~92%
1-[2-Amino-1-(4... CAS#:130198-05-9 |
| Literature: KRKA Patent: WO2007/147564 A1, 2007 ; Location in patent: Page/Page column 12 ; |
|
~72%
1-[2-Amino-1-(4... CAS#:130198-05-9 |
| Literature: TEVA PHARMACEUTICAL INDUSTRIES LTD.; TEVA PHARMACEUTICALS USA, INC. Patent: WO2007/47972 A2, 2007 ; Location in patent: Page/Page column 20 ; |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-[2-Amino-1-(4-methoxyphenyl)ethyl]cyclohexanolhydrochlorid |
| 1-[2-Amino-1-(4-methoxyphenyl)ethyl]cyclohexanol hydrochloride |
| MFCD06658143 |
| L6TJ AY1ZR DO1& AQ &&HCl |
| 1-[2-Amino-1-(4-methoxyphenyl)ethyl]cyclohexanol hydrochloride (1:1) |
| 1-[2-Amino-1-(4-methoxyphenyl)-ethyl]-cyclohexanol hydrochloride |
| Cyclohexanol, 1-[2-amino-1-(4-methoxyphenyl)ethyl]-, hydrochloride (1:1) |
| 1-(2-Amino-1-(4-methoxyphenyl)ethyl)cyclohexanol hydrochloride |
| Venlafaxine Impurity 3 |