TERT-BUTYL (S)-(-)-5-BENZYL-2-OXO-4- structure
|
Common Name | TERT-BUTYL (S)-(-)-5-BENZYL-2-OXO-4- | ||
|---|---|---|---|---|
| CAS Number | 130317-10-1 | Molecular Weight | 291.34200 | |
| Density | 1.162g/cm3 | Boiling Point | 441.1ºC at 760mmHg | |
| Molecular Formula | C16H21NO4 | Melting Point | 98-100ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 220.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-butyl (5S)-5-benzyl-2-oxomorpholine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 441.1ºC at 760mmHg |
| Melting Point | 98-100ºC(lit.) |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.34200 |
| Flash Point | 220.6ºC |
| Exact Mass | 291.14700 |
| PSA | 55.84000 |
| LogP | 2.32950 |
| Vapour Pressure | 5.6E-08mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | NQZZZVQLJCFCGL-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)OCC1Cc1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(tert-Butoxycarbonyl)-5S-benzyl-2H-1,4-oxazin-2-one |
| tert-Butyl (S)-(-)-5-benzyl-2-oxo-4-morpholinecarboxylate |
| MFCD01863515 |
| (S)-(-)-N-Boc-5-benzyl-2-oxomorpholine |