2-amino-6-[(1S,2S)-1,2-dihydroxypropyl]-4(1H)-Pteridinone structure
|
Common Name | 2-amino-6-[(1S,2S)-1,2-dihydroxypropyl]-4(1H)-Pteridinone | ||
|---|---|---|---|---|
| CAS Number | 13039-82-2 | Molecular Weight | 237.21500 | |
| Density | 1.86g/cm3 | Boiling Point | 590.2ºC at 760mmHg | |
| Molecular Formula | C9H11N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.7ºC | |
| Name | orinapterin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.86g/cm3 |
|---|---|
| Boiling Point | 590.2ºC at 760mmHg |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.21500 |
| Flash Point | 310.7ºC |
| Exact Mass | 237.08600 |
| PSA | 139.00000 |
| Vapour Pressure | 8.98E-15mmHg at 25°C |
| Index of Refraction | 1.821 |
| InChIKey | LHQIJBMDNUYRAM-BBIVZNJYSA-N |
| SMILES | CC(O)C(O)c1cnc2nc(N)[nH]c(=O)c2n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ciliapterin |
| Orinapterin |
| L-Dictyopterin |
| L-Erythro-Biopterin |
| biopterin |
| L-threo-Biopterin |
| 2-amino-6-[(1S,2S)-1,2-dihydroxypropyl]-1H-pteridin-4-one |