[1,1'-Biphenyl]-4,4'-diol,3,3',5,5'-tetrachloro- structure
|
Common Name | [1,1'-Biphenyl]-4,4'-diol,3,3',5,5'-tetrachloro- | ||
|---|---|---|---|---|
| CAS Number | 13049-13-3 | Molecular Weight | 323.98700 | |
| Density | 1.624g/cm3 | Boiling Point | 389.6ºC at 760 mmHg | |
| Molecular Formula | C12H6Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.4ºC | |
| Name | 3,3',5,5'-tetrachlorobiphenyl-4,4'-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.624g/cm3 |
|---|---|
| Boiling Point | 389.6ºC at 760 mmHg |
| Molecular Formula | C12H6Cl4O2 |
| Molecular Weight | 323.98700 |
| Flash Point | 189.4ºC |
| Exact Mass | 321.91200 |
| PSA | 40.46000 |
| LogP | 5.37840 |
| Vapour Pressure | 1.25E-06mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | YCYDXOVJXVALHY-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(-c2cc(Cl)c(O)c(Cl)c2)cc1Cl |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 3,3',5,5'-Tetrachloro-4,4'-biphenyldiol |
| 3,3',5,5'-tetrachloro-4,4'-diphenol |
| 3.5.3'.5'-Tetrachlor-4.4'-dioxy-diphenyl |
| 4,4'-Biphenyldiol,3,3',5,5'-tetrachloro |
| 3,5,3',5'-TETRACHLORO-BIPHENYL-4,4'-DIOL |
| 2,6-dichloro-4-(3,5-dichloro-4-hydroxyphenyl)phenol |
| 4,4'-Dihydroxy-3,3',5,5'-tetrachlorobiphenyl |
| 3,5,3',5'-Tetrachlor-biphenyl-4,4'-diol |