2,2',6,6'-Tetramethyl-p,p'-biphenol structure
|
Common Name | 2,2',6,6'-Tetramethyl-p,p'-biphenol | ||
|---|---|---|---|---|
| CAS Number | 2417-04-1 | Molecular Weight | 242.313 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 354.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C16H18O2 | Melting Point | 222-225 °C(lit.) | |
| MSDS | N/A | Flash Point | 162.4±21.1 °C | |
| Name | 4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.6±37.0 °C at 760 mmHg |
| Melting Point | 222-225 °C(lit.) |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.313 |
| Flash Point | 162.4±21.1 °C |
| Exact Mass | 242.130676 |
| PSA | 40.46000 |
| LogP | 4.26 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | YGYPMFPGZQPETF-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2cc(C)c(O)c(C)c2)cc(C)c1O |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 3,3,5,5-Tetramehtyl [1,1'-biphenyl] 4,4'-diol |
| 4,4'-dihydroxy-3,3',5,5'-tetramethyl biphenyl |
| 3,3',5,5'-Tetramethyl-4,4'-biphenyldiol |
| 3,3',5,5'-Tetramethylbiphenyl-4,4'-diol |
| 3,3',5,5'-tetramethyl-4,4'-dihydroxybiphenyl |
| 2,2',6,6'-tetramethyl-4,4'-biphenol |
| (1,1'-Biphenyl)-4,4'-diol, 3,3',5,5'-tetramethyl- |
| MFCD00094737 |
| [1,1'-Biphenyl]-4,4'-diol, 3,3',5,5'-tetramethyl- |
| 2,2',6,6'-Tetramethyl-p,p'-biphenol |
| 4,4'-Dihydroxy-3,3',5,5'-tetramethylbiphenyl |
| 4,4'-dihydroxy-3,5,3',5'-tetramethylbiphenyl |
| 4,4'-bishydroxy-3,3',5,5'-tetramethyl biphenyl |