Heptafluoroisopropyl acrylate structure
|
Common Name | Heptafluoroisopropyl acrylate | ||
|---|---|---|---|---|
| CAS Number | 13057-08-4 | Molecular Weight | 240.07600 | |
| Density | 1.46 g/cm3 | Boiling Point | 100ºC at 760 mmHg | |
| Molecular Formula | C6H3F7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 15ºC | |
| Name | Heptafluoroisopropyl acrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46 g/cm3 |
|---|---|
| Boiling Point | 100ºC at 760 mmHg |
| Molecular Formula | C6H3F7O2 |
| Molecular Weight | 240.07600 |
| Flash Point | 15ºC |
| Exact Mass | 240.00200 |
| PSA | 26.30000 |
| LogP | 2.50600 |
| Index of Refraction | 1.312 |
| InChIKey | JTCVKNUSIGHJRG-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC(F)(C(F)(F)F)C(F)(F)F |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant;F: Flammable; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2916129000 |
| HS Code | 2916129000 |
|---|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 235-943-9 |
| 1,1,1,2,3,3,3-heptafluoropropan-2-yl prop-2-enoate |
| MFCD00274356 |