4-(4-nitrophenethyl)piperazine-1-carboxylic acid tert butyl ester structure
|
Common Name | 4-(4-nitrophenethyl)piperazine-1-carboxylic acid tert butyl ester | ||
|---|---|---|---|---|
| CAS Number | 130636-60-1 | Molecular Weight | 335.39800 | |
| Density | 1.173g/cm3 | Boiling Point | 455.5ºC at 760 mmHg | |
| Molecular Formula | C17H25N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.3ºC | |
| Name | tert-butyl 4-[2-(4-nitrophenyl)ethyl]piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 455.5ºC at 760 mmHg |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.39800 |
| Flash Point | 229.3ºC |
| Exact Mass | 335.18500 |
| PSA | 78.60000 |
| LogP | 3.08900 |
| Vapour Pressure | 1.74E-08mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | RBEXASHZNSBASY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCc2ccc([N+](=O)[O-])cc2)CC1 |
|
~32%
4-(4-nitrophene... CAS#:130636-60-1 |
| Literature: Kanojia, Ramesh M.; Salata, Joseph J.; Kauffman, Jack Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 24 p. 2819 - 2823 |
|
~%
4-(4-nitrophene... CAS#:130636-60-1 |
| Literature: Mitsui Toatsu Chemicals, Incorporated Patent: US5008267 A1, 1991 ; |
| 1-[2-(4-nitrophenyl)ethyl]-4-tert-butyloxycarbonylpiperazine |
| 4-(4-nitrophenethyl)piperazine-1-carboxylic acid tert butyl ester |
| 4-[2-(4-nitro-phenyl)-ethyl]-piperazine-1-carboxylic acid tert-butyl ester |