1-(2-Bromoethyl)-4-nitrobenzene structure
|
Common Name | 1-(2-Bromoethyl)-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 5339-26-4 | Molecular Weight | 230.059 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 309.6±17.0 °C at 760 mmHg | |
| Molecular Formula | C8H8BrNO2 | Melting Point | 67-69 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 141.0±20.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Nitrophenethyl Bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 309.6±17.0 °C at 760 mmHg |
| Melting Point | 67-69 °C(lit.) |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.059 |
| Flash Point | 141.0±20.9 °C |
| Exact Mass | 228.973831 |
| PSA | 45.82000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | NTURQZFFJDCTMZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CCBr)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38;R43 |
| Safety Phrases | S26-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29049085 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
An ensemble of theta class glutathione transferases with novel catalytic properties generated by stochastic recombination of fragments of two mammalian enzymes.
J. Mol. Biol. 318(1) , 59-70, (2002) The correlation between sequence diversity and enzymatic function was studied in a library of Theta class glutathione transferases (GSTs) obtained by stochastic recombination of fragments of cDNA enco... |
|
|
Residue 234 in glutathione transferase T1-1 plays a pivotal role in the catalytic activity and the selectivity against alternative substrates.
Biochem. J. 388(Pt 1) , 387-92, (2005) GST (glutathione transferase) T1-1 plays an important role in the biotransformation of halogenated alkanes, which are used in large quantities as solvents and occur as environmental pollutants. Many r... |
|
|
A glutathione S-transferase (GST) isozyme from broccoli with significant sequence homology to the mammalian theta-class of GSTs.
Biochim. Biophys. Acta 1205(1) , 29-38, (1994) A novel glutathione S-transferase (GST) was purified from broccoli (Brassica oleracea var. italica). Partial amino-acid sequencing indicated that the protein shared significant homology with several d... |
| 1-(2-Bromoethyl)-4-nitrobenzene |
| β-(p-Nitrophenyl)ethyl bromide |
| 4-(2-bromoethyl)nitrobenzene |
| 4-Nitrophenethyl bromide |
| Benzene, 1- (2-bromoethyl)-4-nitro- |
| Benzene, 1-(2-bromoethyl)-4-nitro- |
| EINECS 226-271-7 |
| MFCD00007386 |
| 4-Nitrophenethylbromide |
| 2-(4-Nitrophenyl)ethyl Bromide |