cyanofenphos structure
|
Common Name | cyanofenphos | ||
|---|---|---|---|---|
| CAS Number | 13067-93-1 | Molecular Weight | 303.31600 | |
| Density | 1.26g/cm3 | Boiling Point | 423.7ºC at 760mmHg | |
| Molecular Formula | C15H14NO2PS | Melting Point | 83ºC | |
| MSDS | N/A | Flash Point | >100 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | cyanofenphos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 423.7ºC at 760mmHg |
| Melting Point | 83ºC |
| Molecular Formula | C15H14NO2PS |
| Molecular Weight | 303.31600 |
| Flash Point | >100 °C |
| Exact Mass | 303.04800 |
| PSA | 84.15000 |
| LogP | 4.25918 |
| Vapour Pressure | 1.76E-08mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | LRNJHZNPJSPMGK-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(Oc1ccc(C#N)cc1)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302-H312-H319-H332 |
| Precautionary Statements | P210-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N,Xn,F |
| Risk Phrases | R21 |
| Safety Phrases | 36/37-45-61-26 |
| RIDADR | 2783 |
| WGK Germany | 3 |
| RTECS | TB1750000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2930909090 |
|
~35%
cyanofenphos CAS#:13067-93-1 |
| Literature: Yoshikawa, Hiromichi Bioscience, Biotechnology and Biochemistry, 1999 , vol. 63, # 2 p. 424 - 426 |
|
~%
cyanofenphos CAS#:13067-93-1 |
| Literature: Bioscience, Biotechnology and Biochemistry, , vol. 63, # 2 p. 424 - 426 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Delayed neurotoxicity in the wild mallard duckling caused by the organophosphorus insecticides cyanofenphos and leptophos.
J. Environ. Sci. Health B 21(5) , 401-11, (1986) The susceptibility of wild mallard ducklings to the delayed neurotoxic effect of the neurotoxic organophosphorus insecticides cyanofenphos and leptophos was evaluated following a daily dosing regimen.... |
|
|
In vivo inhibition of chicken brain acetylcholinesterase and neurotoxic esterase in relation to the delayed neurotoxicity of leptophos and cyanofenphos.
J. Environ. Pathol. Toxicol. Oncol. 7(1-2) , 211-24, (1986) An equimolal single dose (1 mmole/kg) of leptophos or cyanofenphos was given orally to chickens to assay the clinical and biochemical neurotoxic effects of these two organophosphorus insecticides. Par... |
|
|
Protective effect of pretreatment against the anticholinesterase action of cyanofenphos.
Dev. Toxicol. Environ. Sci. 11 , 503-6, (1983)
|
| s4087 |
| SUD |
| O-p-cyanophenyl O-ethyl phenyl-phosphonothioate |
| Surazon |
| cyp (jmaf) |
| O-(4-cyanophenyl) O-ethyl P-phenylphosphonothioate |
| O-p-cyanophenyl O-ethyl phenylphosphonothionate |
| racemic O-(4-cyanophenyl) O-ethyl phenylphosphonothionate |
| (Ξ)-[O-4-(cyanophenyl) O-ethyl phenylphosphonothioate] |
| MFCD00055313 |
| OMS 870 |
| (RS)-(O-4-cyanophenyl O-ethyl phenylphosphonothioate) |
| O-4-cyanophenyl O-ethyl phenylphosphonothioate |
| CYP |
| ent25,832 |
| Surecide |
| EINECS 200-835-2 |
| CYANOFENPHOS |