diisopropyl o,o'-bis(trimethylsilyl)-l-tartrate structure
|
Common Name | diisopropyl o,o'-bis(trimethylsilyl)-l-tartrate | ||
|---|---|---|---|---|
| CAS Number | 130678-42-1 | Molecular Weight | 378.60900 | |
| Density | 0.982g/cm3 | Boiling Point | 338.9ºC at 760mmHg | |
| Molecular Formula | C16H34O6Si2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 132ºC | |
| Name | dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.982g/cm3 |
|---|---|
| Boiling Point | 338.9ºC at 760mmHg |
| Molecular Formula | C16H34O6Si2 |
| Molecular Weight | 378.60900 |
| Flash Point | 132ºC |
| Exact Mass | 378.18900 |
| PSA | 71.06000 |
| LogP | 3.32980 |
| Vapour Pressure | 9.51E-05mmHg at 25°C |
| Index of Refraction | n20/D 1.428(lit.) |
| InChIKey | WTAZEIUCUCCYIA-ZIAGYGMSSA-N |
| SMILES | CC(C)OC(=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)OC(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| Safety Phrases | S23-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~98%
diisopropyl o,o... CAS#:130678-42-1 |
| Literature: Knierzinger, Andreas; Walther, Willy; Weber, Beat; Mueller, Robert Karl; Netscher, Thomas Helvetica Chimica Acta, 1990 , vol. 73, # 4 p. 1087 - 1107 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| MFCD00192055 |