Oxiranemethanamine, N,N-methylenebis(2-ethyl-4,1-phenylene)bisN-(oxiranylmethyl)- structure
|
Common Name | Oxiranemethanamine, N,N-methylenebis(2-ethyl-4,1-phenylene)bisN-(oxiranylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 130728-76-6 | Molecular Weight | 478.62300 | |
| Density | 1.221g/cm3 | Boiling Point | 647.3ºC at 760mmHg | |
| Molecular Formula | C29H38N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | 4-[[4-[bis(oxiran-2-ylmethyl)amino]-3-ethylphenyl]methyl]-2-ethyl-N,N-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 647.3ºC at 760mmHg |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.62300 |
| Flash Point | 175.3ºC |
| Exact Mass | 478.28300 |
| PSA | 56.60000 |
| LogP | 3.61020 |
| Vapour Pressure | 1.21E-16mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | PMPLQTWAQNSOSY-UHFFFAOYSA-N |
| SMILES | CCc1cc(Cc2ccc(N(CC3CO3)CC3CO3)c(CC)c2)ccc1N(CC1CO1)CC1CO1 |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | 43-68-51/53 |
| Safety Phrases | 36/37-61 |
| N,N,N'N'-tetraglycidyl-3,3'-diethyl-4,4'-diaminodiphenylmethane |
| XU MY 722 |