Sipatrigine structure
|
Common Name | Sipatrigine | ||
|---|---|---|---|---|
| CAS Number | 130800-90-7 | Molecular Weight | 372.68 | |
| Density | 1.419 g/cm3 | Boiling Point | 531.1ºC at 760 mmHg | |
| Molecular Formula | C15H16Cl3N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275ºC | |
Use of SipatrigineSipatrigine, a neuroprotective agent, is a glutamate release inhibitor, voltage-dependent sodium channel and calcium channel inhibitor, penetrating the central nervous system. Has potential to treat focal cerebral ischemia and stroke[1][2]. |
| Name | 2-(4-methylpiperazin-1-yl)-5-(2,3,5-trichlorophenyl)pyrimidin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Description | Sipatrigine, a neuroprotective agent, is a glutamate release inhibitor, voltage-dependent sodium channel and calcium channel inhibitor, penetrating the central nervous system. Has potential to treat focal cerebral ischemia and stroke[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Sodium channel, calcium channel[1][2]. |
| References |
| Density | 1.419 g/cm3 |
|---|---|
| Boiling Point | 531.1ºC at 760 mmHg |
| Molecular Formula | C15H16Cl3N5 |
| Molecular Weight | 372.68 |
| Flash Point | 275ºC |
| Exact Mass | 371.04700 |
| PSA | 58.28000 |
| LogP | 4.02190 |
| InChIKey | PDOCBJADCWMDGL-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2ncc(-c3cc(Cl)cc(Cl)c3Cl)c(N)n2)CC1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-Methyl-1-piperazinyl)-5-(2,3,5-trichlorophenyl)-4-pyrimidinamine |
| Sipatrigine [INN:BAN] |
| 619C89 |
| 4-Amino-2-(4-methyl-1-piperazinyl)-5-(2,3,5-trichlorophenyl)pyrimidine |
| Sipatrigine |
| BW619C89 |