1H-Indazole, 3-phenyl- structure
|
Common Name | 1H-Indazole, 3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 13097-01-3 | Molecular Weight | 194.23200 | |
| Density | 1.211g/cm3 | Boiling Point | 405.1ºC at 760mmHg | |
| Molecular Formula | C13H10N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.1°C | |
| Name | 3-phenyl-1h-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 405.1ºC at 760mmHg |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.23200 |
| Flash Point | 192.1°C |
| Exact Mass | 194.08400 |
| PSA | 28.68000 |
| LogP | 3.22990 |
| Vapour Pressure | 2.1E-06mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | MXBKCOLSUUYOHT-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2n[nH]c3ccccc23)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole,3-phenyl |