Meptyldinocap structure
|
Common Name | Meptyldinocap | ||
|---|---|---|---|---|
| CAS Number | 131-72-6 | Molecular Weight | 364.39300 | |
| Density | 1.175 g/cm3 | Boiling Point | 473.7ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 173.9ºC | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Danger | |
Use of MeptyldinocapMeptyldinocap (2,4-DNOPC) is a novel powdery mildew (Erysiphe necator) fungicide which shows protectant and post-infective activities. |
| Name | meptyldinocap |
|---|---|
| Synonym | More Synonyms |
| Description | Meptyldinocap (2,4-DNOPC) is a novel powdery mildew (Erysiphe necator) fungicide which shows protectant and post-infective activities. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.175 g/cm3 |
|---|---|
| Boiling Point | 473.7ºC at 760 mmHg |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.39300 |
| Flash Point | 173.9ºC |
| Exact Mass | 364.16300 |
| PSA | 117.94000 |
| LogP | 6.10480 |
| Vapour Pressure | 3.85E-09mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | NIOPZPCMRQGZCE-WEVVVXLNSA-N |
| SMILES | CC=CC(=O)Oc1c(C(C)CCCCCC)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| Storage condition | 0-6°C |
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302 + H332-H315-H317-H360D-H373-H410 |
| Precautionary Statements | P201-P273-P280-P308 + P313-P501 |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
| Risk Phrases | R10 |
| Safety Phrases | 53-36/37-45-60-61 |
| RIDADR | UN 3082 9 / PGIII |
| HS Code | 2916190090 |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| KARATHAN |
| CROTOTHANE |
| DINOCAP |
| dinitromethylheptylphenyl crotonate |
| SIALITE |
| Meptyldinocap |
| EINECS 254-408-0 |
| KARATHANE |
| rac-2,4-dinitro 6-[(2R)-octan-2-yl]phenyl (2E)-but-2-enoate |
| (RS)-2-(1-methylheptyl)-4,6-dinitrophenyl crotonate |
| 2-(1-methylheptyl)-4,6-dinitrophenyl (2E)-2-butenoate |
| (RS)-2-(1-Methylheptyl)-4,6-dinitrophenyl crotonate (2-(1-Methylheptyl)-4,6-dinitrophenyl |