tert-butyl 2-Methoxy-2-Methylpropylcarbamate structure
|
Common Name | tert-butyl 2-Methoxy-2-Methylpropylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 1311254-74-6 | Molecular Weight | 203.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-(2-methoxy-2-methylpropyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H21NO3 |
|---|---|
| Molecular Weight | 203.27900 |
| Exact Mass | 203.15200 |
| PSA | 51.05000 |
| LogP | 2.14050 |
| InChIKey | OCIHEYUEIBOCSJ-UHFFFAOYSA-N |
| SMILES | COC(C)(C)CNC(=O)OC(C)(C)C |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n-boc-2-methoxy-2-methylpropylamine |
| sc4191 |