3-NITRO-2-NAPHTHYLAMINE structure
|
Common Name | 3-NITRO-2-NAPHTHYLAMINE | ||
|---|---|---|---|---|
| CAS Number | 13115-28-1 | Molecular Weight | 188.18300 | |
| Density | 1.366g/cm3 | Boiling Point | 397.6ºC at 760mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.3ºC | |
| Name | 3-nitronaphthalen-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 397.6ºC at 760mmHg |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18300 |
| Flash Point | 194.3ºC |
| Exact Mass | 188.05900 |
| PSA | 71.84000 |
| LogP | 3.43460 |
| Vapour Pressure | 1.56E-06mmHg at 25°C |
| Index of Refraction | 1.728 |
| InChIKey | ZAXOISFBCDOZER-UHFFFAOYSA-N |
| SMILES | Nc1cc2ccccc2cc1[N+](=O)[O-] |
| HS Code | 2921450090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 8 | |
| HS Code | 2921450090 |
|---|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Amino-3-nitro-naphthalin |
| 3-nitro-2-naphthalenamine |
| 2-Naphthalenamine,3-nitro |
| 3-Nitro-2-amino-naphthalin |
| 2-Amino-3-nitronaphthalene |
| 2-NAPHTHYLAMINE,3-NITRO |