3-NITRO-2-NAPHTHALDEHYDE structure
|
Common Name | 3-NITRO-2-NAPHTHALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 73428-05-4 | Molecular Weight | 201.17800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-nitronaphthalene-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H7NO3 |
|---|---|
| Molecular Weight | 201.17800 |
| Exact Mass | 201.04300 |
| PSA | 62.89000 |
| LogP | 3.08370 |
| InChIKey | SMFXJXWPJBCOHC-UHFFFAOYSA-N |
| SMILES | O=Cc1cc2ccccc2cc1[N+](=O)[O-] |
|
~99%
3-NITRO-2-NAPHT... CAS#:73428-05-4 |
| Literature: UNIVERSITY OF ROCHESTER; MILLER, Benjamin, L.; OFORI, Leslie, O.; GROMOVA, Anna, V. Patent: WO2012/92367 A1, 2012 ; Location in patent: Page/Page column 47 ; |
|
~%
3-NITRO-2-NAPHT... CAS#:73428-05-4 |
| Literature: Wani; Ronman; Lindley; Wall Journal of Medicinal Chemistry, 1980 , vol. 23, # 5 p. 554 - 560 |
|
~%
3-NITRO-2-NAPHT... CAS#:73428-05-4 |
| Literature: Kienzle, Frank Helvetica Chimica Acta, 1980 , vol. 63, # 8 p. 2364 - 2369 |
| 3-nitro-2-naphthaldehyde |
| 2-Naphthalenecarboxaldehyde,3-nitro |
| 3-Nitronaphthalene-2-carboxaldehyde |
| 3-nitro-2-naphtaldehyde |