Bis(4-fluorophenyl)[(2S)-2-pyrrolidinyl]methanol structure
|
Common Name | Bis(4-fluorophenyl)[(2S)-2-pyrrolidinyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 131180-45-5 | Molecular Weight | 289.320 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 404.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H17F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.3±27.3 °C | |
| Name | bis(4-fluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 404.3±40.0 °C at 760 mmHg |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.320 |
| Flash Point | 198.3±27.3 °C |
| Exact Mass | 289.127808 |
| PSA | 32.26000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | MFOIELLUBQRIOJ-INIZCTEOSA-N |
| SMILES | OC(c1ccc(F)cc1)(c1ccc(F)cc1)C1CCCN1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Bis(4-fluorophenyl)[(2S)-2-pyrrolidinyl]methanol |
| hms2164h21 |
| 2-Pyrrolidinemethanol, α,α-bis(4-fluorophenyl)-, (2S)- |