Bis(4-methylphenyl)[(2S)-2-pyrrolidinyl]methanol structure
|
Common Name | Bis(4-methylphenyl)[(2S)-2-pyrrolidinyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 131180-52-4 | Molecular Weight | 281.392 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 442.3±15.0 °C at 760 mmHg | |
| Molecular Formula | C19H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.3±11.0 °C | |
| Name | bis(4-methylphenyl)-[(2S)-pyrrolidin-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 442.3±15.0 °C at 760 mmHg |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.392 |
| Flash Point | 123.3±11.0 °C |
| Exact Mass | 281.177979 |
| PSA | 32.26000 |
| LogP | 3.83 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | FFFPARXSSPKJIS-SFHVURJKSA-N |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C2CCCN2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyrrolidinemethanol, α,α-bis(4-methylphenyl)-, (2S)- |
| Bis(4-methylphenyl)[(2S)-2-pyrrolidinyl]methanol |
| educt for 6d |