(S)-N-Fmoc-2-(6'-heptenyl)alanine structure
|
Common Name | (S)-N-Fmoc-2-(6'-heptenyl)alanine | ||
|---|---|---|---|---|
| CAS Number | 1311933-83-1 | Molecular Weight | 407.502 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 613.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H29NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.8±31.5 °C | |
Use of (S)-N-Fmoc-2-(6'-heptenyl)alanine(S)-N-FMoc-2-(6'-heptenyl)alanine is a amino acid, which can be used in peptide synthesis[1]. |
| Name | (S)-N-Fmoc-2-(6'-heptenyl)alanine |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-N-FMoc-2-(6'-heptenyl)alanine is a amino acid, which can be used in peptide synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 613.4±55.0 °C at 760 mmHg |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.502 |
| Flash Point | 324.8±31.5 °C |
| Exact Mass | 407.209656 |
| PSA | 75.63000 |
| LogP | 6.57 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | WSTJGDVRPQAMSC-VWLOTQADSA-N |
| SMILES | C=CCCCCCC(C)(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| Storage condition | 2-8°C |
| 8-Nonenoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-, (2S)- |
| (2S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-8-nonenoic acid |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-2-methyl-8-nonenoic acid |