(S)-N-Fmoc-2-(3'-butenyl)alanine structure
|
Common Name | (S)-N-Fmoc-2-(3'-butenyl)alanine | ||
|---|---|---|---|---|
| CAS Number | 288617-72-1 | Molecular Weight | 365.422 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 575.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C22H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.9±28.7 °C | |
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhex-5-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 575.6±45.0 °C at 760 mmHg |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.422 |
| Flash Point | 301.9±28.7 °C |
| Exact Mass | 365.162720 |
| PSA | 79.12000 |
| LogP | 5.13 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | ZZWOKVRONYEEBJ-QFIPXVFZSA-N |
| SMILES | C=CCCC(C)(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Hexenoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-, (2S)- |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-2-methyl-5-hexenoic acid |