Syk-IN-3
Modify Date: 2025-08-27 16:03:06
Syk-IN-3 structure
|
Common Name | Syk-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 1312534-69-2 | Molecular Weight | 452.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H28N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Syk-IN-3Syk-IN-3, a potent spleen tyrosine kinase (Syk) inhibitor, extracted from patent WO2011075515A1, compound example 152, has an IC50 of 1 nM[1]. |
| Name | Syk-IN-3 |
|---|
| Description | Syk-IN-3, a potent spleen tyrosine kinase (Syk) inhibitor, extracted from patent WO2011075515A1, compound example 152, has an IC50 of 1 nM[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Muller S, et al. Donated chemical probes for open science.CITE THIS ARTICLEAS: eLife 2018;7:e34311. |
| Molecular Formula | C24H28N4O3S |
|---|---|
| Molecular Weight | 452.57 |
| InChIKey | OYKPWSZSBLRRPL-HOYKHHGWSA-N |
| SMILES | Cc1cc(Nc2nccc(C)n2)cc(-c2cnc(C3(O)CCC(C(=O)O)C(C)(C)C3)s2)c1 |