4-(Ethoxycarbonyl)phenylzinc iodide solution 0.5M in THF structure
|
Common Name | 4-(Ethoxycarbonyl)phenylzinc iodide solution 0.5M in THF | ||
|---|---|---|---|---|
| CAS Number | 131379-16-3 | Molecular Weight | 341.45100 | |
| Density | 1.018 g/mL at 25ºC | Boiling Point | 211.7ºC at 760 mmHg | |
| Molecular Formula | C9H9IO2Zn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | 4-(ethoxycarbonyl)phenylzinc iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.018 g/mL at 25ºC |
|---|---|
| Boiling Point | 211.7ºC at 760 mmHg |
| Molecular Formula | C9H9IO2Zn |
| Molecular Weight | 341.45100 |
| Flash Point | 1 °F |
| Exact Mass | 339.89400 |
| PSA | 26.30000 |
| LogP | 2.54670 |
| Vapour Pressure | 0.18mmHg at 25°C |
| InChIKey | DVAYVJGYZRYJEV-UHFFFAOYSA-M |
| SMILES | CCOC(=O)c1cc[c-]cc1.[Zn+]I |
| Storage condition | 2-8℃ |
|
~76%
Detail
|
| Literature: Journal of the American Chemical Society, , vol. 125, # 13 p. 3867 - 3870 |
|
~5%
4-(Ethoxycarbon... CAS#:131379-16-3 |
| Literature: Angewandte Chemie - International Edition, , vol. 45, # 36 p. 6040 - 6044 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| 4-(ethoxycarbonyl)phenylzinc iodide solution |
| 4-(Iodozincio)benzoic acid ethyl ester |
| p-EtO2CC6H4ZnI |
| 4-(ethoxycarbonyl)-phenylzinc iodide |
| 4-(Ethoxycarbonyl)phenylzinc iodide solution 0.5 in THF |
| MFCD00671982 |
| (4-(ethoxycarbonyl)phenyl)zinc(II) iodide |
| [4-(ethoxycarbonyl)phenyl](iodo)zinc |
| Ethyl 4-(iodozincio)benzoate |