Urea,N-(3-methoxyphenyl)-N'-phenyl- structure
|
Common Name | Urea,N-(3-methoxyphenyl)-N'-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 13142-83-1 | Molecular Weight | 242.27300 | |
| Density | 1.249g/cm3 | Boiling Point | 300.5ºC at 760mmHg | |
| Molecular Formula | C14H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.5ºC | |
| Name | 1-(3-methoxyphenyl)-3-phenylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 300.5ºC at 760mmHg |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.27300 |
| Flash Point | 135.5ºC |
| Exact Mass | 242.10600 |
| PSA | 50.36000 |
| LogP | 3.48520 |
| Vapour Pressure | 0.00112mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | BYDALDRWUBYRDE-UHFFFAOYSA-N |
| SMILES | COc1cccc(NC(=O)Nc2ccccc2)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N'-m-Methoxy-phenyl-N-phenyl-harnstoff |