Urea,N-(3-nitrophenyl)-N'-phenyl- structure
|
Common Name | Urea,N-(3-nitrophenyl)-N'-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 2000-54-6 | Molecular Weight | 257.24500 | |
| Density | 1.415g/cm3 | Boiling Point | 322.8ºC at 760mmHg | |
| Molecular Formula | C13H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149ºC | |
| Name | 1-(3-nitrophenyl)-3-phenylurea |
|---|
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 322.8ºC at 760mmHg |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.24500 |
| Flash Point | 149ºC |
| Exact Mass | 257.08000 |
| PSA | 86.95000 |
| LogP | 3.90800 |
| Vapour Pressure | 0.000274mmHg at 25°C |
| Index of Refraction | 1.718 |
| InChIKey | MKGHYUVMRJIWPW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)Nc1cccc([N+](=O)[O-])c1 |
| HS Code | 2924299090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |