8-Benzoyl-1-naphthoic acid structure
|
Common Name | 8-Benzoyl-1-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 13148-24-8 | Molecular Weight | 276.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-benzoylnaphthalene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H12O3 |
|---|---|
| Molecular Weight | 276.28600 |
| Exact Mass | 276.07900 |
| PSA | 54.37000 |
| LogP | 3.76900 |
| InChIKey | PPBYXQZWLRJRAP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2cccc(C(=O)c3ccccc3)c12 |
| HS Code | 2918300090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 8-benzoyl-1-naphthalenecarboxylic acid |
| 1-Naphthalenecarboxylic acid,8-benzoyl |