2-(4-fluorobenzoyl)naphthalene-1-carboxylic acid
Modify Date: 2025-09-18 12:00:47
2-(4-fluorobenzoyl)naphthalene-1-carboxylic acid structure
|
Common Name | 2-(4-fluorobenzoyl)naphthalene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 3870-15-3 | Molecular Weight | 294.27700 | |
| Density | 1.347g/cm3 | Boiling Point | 531.8ºC at 760 mmHg | |
| Molecular Formula | C18H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.4ºC | |
| Name | 2-(4-fluorobenzoyl)naphthalene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 531.8ºC at 760 mmHg |
| Molecular Formula | C18H11FO3 |
| Molecular Weight | 294.27700 |
| Flash Point | 275.4ºC |
| Exact Mass | 294.06900 |
| PSA | 54.37000 |
| LogP | 3.90810 |
| Index of Refraction | 1.661 |
| InChIKey | WZZGNSQXZZKCKM-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)c1ccc2ccccc2c1C(=O)O |
| HS Code | 2918300090 |
|---|
|
~%
2-(4-fluorobenz... CAS#:3870-15-3 |
| Literature: Newman et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1961,1964 |
|
~%
2-(4-fluorobenz... CAS#:3870-15-3 |
| Literature: Newman et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1961,1964 |
![Naphtho[1,2-c]furan-1,3-dione structure](https://image.chemsrc.com/caspic/254/5343-99-7.png)
CAS#:2070-08-8| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-(4-fluoro-benzoyl)-[1]naphthoic acid |
| 2-(4-Fluor-benzoyl)-[1]naphthoesaeure |