nitrososulfamethoxazole structure
|
Common Name | nitrososulfamethoxazole | ||
|---|---|---|---|---|
| CAS Number | 131549-85-4 | Molecular Weight | 267.26100 | |
| Density | 1.53g/cm3 | Boiling Point | 472.9ºC at 760mmHg | |
| Molecular Formula | C10H9N3O4S | Melting Point | >180°C (dec.) | |
| MSDS | Chinese USA | Flash Point | 239.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | nitrososulfamethoxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 472.9ºC at 760mmHg |
| Melting Point | >180°C (dec.) |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.26100 |
| Flash Point | 239.8ºC |
| Exact Mass | 267.03100 |
| PSA | 110.01000 |
| LogP | 3.33550 |
| Vapour Pressure | 4.1E-09mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | GHNQGDUYHCZZPT-UHFFFAOYSA-N |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(N=O)cc2)no1 |
| Storage condition | -20?C Freezer, Under Inert Atmosphere |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38-43 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
|
~87%
nitrososulfamet... CAS#:131549-85-4 |
| Literature: Naisbitt, Dean J.; Neill, Paul M.; Pirmohamed, Munir; Park, B. Kevin Bioorganic and Medicinal Chemistry Letters, 1996 , vol. 6, # 13 p. 1511 - 1516 |
|
~%
nitrososulfamet... CAS#:131549-85-4 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 6, # 13 p. 1511 - 1516 |
|
~%
nitrososulfamet... CAS#:131549-85-4 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 6, # 13 p. 1511 - 1516 |
| N-(5-Methyl-3-isoxazolyl)-4-nitrosobenzenesulfonamide |
| 4-Nitrososulfamethoxazole |
| N-(5-methyl-1,2-oxazol-3-yl)-4-nitrosobenzenesulfonamide |
| 4-Nitroso Sulfamethoxazole |