N-[4-(DIMETHYLAMINO)BENZYL]-N-(4-METHOXYPHENYL)AMINE structure
|
Common Name | N-[4-(DIMETHYLAMINO)BENZYL]-N-(4-METHOXYPHENYL)AMINE | ||
|---|---|---|---|---|
| CAS Number | 13159-99-4 | Molecular Weight | 256.34300 | |
| Density | 1.106g/cm3 | Boiling Point | 409.2ºC at 760mmHg | |
| Molecular Formula | C16H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.3ºC | |
| Name | 4-[(4-methoxyanilino)methyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 409.2ºC at 760mmHg |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.34300 |
| Flash Point | 201.3ºC |
| Exact Mass | 256.15800 |
| PSA | 24.50000 |
| LogP | 3.44630 |
| Vapour Pressure | 6.63E-07mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | RDKKBVHEHXPZQH-UHFFFAOYSA-N |
| SMILES | COc1ccc(NCc2ccc(N(C)C)cc2)cc1 |
| HS Code | 2922299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| (4-dimethylaminophenylmethyl)(4-methoxyphenyl)amine |
| 4-{[(4-methoxyphenyl)amino]methyl}-N,N-dimethylaniline |
| N-[4-(dimethylamino)benzyl]-N-(4-methoxyphenyl)amine |