Ethyl 2-(trifluoromethyl)thiazole-5-carboxylate structure
|
Common Name | Ethyl 2-(trifluoromethyl)thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 131748-96-4 | Molecular Weight | 225.188 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 194.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H6F3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 71.6±27.3 °C | |
| Name | ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 194.8±40.0 °C at 760 mmHg |
| Molecular Formula | C7H6F3NO2S |
| Molecular Weight | 225.188 |
| Flash Point | 71.6±27.3 °C |
| Exact Mass | 225.007126 |
| PSA | 67.43000 |
| LogP | 2.28 |
| Vapour Pressure | 0.4±0.4 mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | KQTWGECEHUVSPX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc(C(F)(F)F)s1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
| Ethyl 2-(trifluoromethyl)thiazole-5-carboxylate |
| 2-Trifluoromethylthiazole-5-carboxylic acid ethyl ester |
| 5-Thiazolecarboxylic acid, 2-(trifluoromethyl)-, ethyl ester |