6-bromo-5,7-dimethyl-2,3-dihydro-1H-inden-1-one structure
|
Common Name | 6-bromo-5,7-dimethyl-2,3-dihydro-1H-inden-1-one | ||
|---|---|---|---|---|
| CAS Number | 131750-27-1 | Molecular Weight | 239.10800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-bromo-5,7-dimethyl-2,3-dihydroinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11BrO |
|---|---|
| Molecular Weight | 239.10800 |
| Exact Mass | 237.99900 |
| PSA | 17.07000 |
| LogP | 3.19480 |
| InChIKey | WQHGVZCBXKEVIU-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(c(C)c1Br)C(=O)CC2 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6-bromo-5,7-dimethyl-1-indanone |
| 6-Bromo-5,7-dimethyl-2,3-dihydro-1H-inden-1-one |
| 6-bromo-5,7-dimethylindan-1-one |
| 1H-Inden-1-one,6-bromo-2,3-dihydro-5,7-dimethyl |