6-bromo-3,3-dimethyl-2H-inden-1-one
Modify Date: 2025-08-25 19:08:58
6-bromo-3,3-dimethyl-2H-inden-1-one structure
|
Common Name | 6-bromo-3,3-dimethyl-2H-inden-1-one | ||
|---|---|---|---|---|
| CAS Number | 67159-84-6 | Molecular Weight | 239.10800 | |
| Density | 1.409±0.06g/ml(Predicted) | Boiling Point | 304.7±41.0℃(Predicted) | |
| Molecular Formula | C11H11BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-bromo-3,3-dimethyl-2H-inden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.409±0.06g/ml(Predicted) |
|---|---|
| Boiling Point | 304.7±41.0℃(Predicted) |
| Molecular Formula | C11H11BrO |
| Molecular Weight | 239.10800 |
| Exact Mass | 237.99900 |
| PSA | 17.07000 |
| LogP | 3.31310 |
| InChIKey | YIFWUKQMDXTIFS-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)c2cc(Br)ccc21 |
| HS Code | 2914700090 |
|---|
|
~42%
6-bromo-3,3-dim... CAS#:67159-84-6 |
| Literature: Bristol-Myers Squibb Co. Patent: US5648385 A1, 1997 ; |
|
~%
6-bromo-3,3-dim... CAS#:67159-84-6 |
| Literature: Atwal, Karnail S.; Ferrara, Francis N.; Ding, Charles Z.; Grover, Gary J.; Sleph, Paul G.; Dzwonczyk, Steven; Baird, Anne J.; Normandin, Diane E. Journal of Medicinal Chemistry, 1996 , vol. 39, # 1 p. 304 - 313 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6-Bromo-3,3-dimethyl-indan-1-one |
| 6-bromo-2,3-dihydro-3,3-dimethyl-1H-inden-1-one |
| 6-Brom-3,3-dimethyl-1-indanon |
| 1,1-dimethyl-5-bromoindan-3-one |
| 5-Bromo-1,1-dimethylindan-3-one |
| 6-Bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one |