1,4-bis(chloromethyl)tetrafluorobenzene structure
|
Common Name | 1,4-bis(chloromethyl)tetrafluorobenzene | ||
|---|---|---|---|---|
| CAS Number | 131803-37-7 | Molecular Weight | 247.01700 | |
| Density | 1.527g/cm3 | Boiling Point | 223ºC at 760 mmHg | |
| Molecular Formula | C8H4Cl2F4 | Melting Point | 77ºC | |
| MSDS | N/A | Flash Point | 101ºC | |
| Name | 1,4-Bis(chloromethyl)-2,3,5,6-tetrafluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.527g/cm3 |
|---|---|
| Boiling Point | 223ºC at 760 mmHg |
| Melting Point | 77ºC |
| Molecular Formula | C8H4Cl2F4 |
| Molecular Weight | 247.01700 |
| Flash Point | 101ºC |
| Exact Mass | 245.96300 |
| LogP | 3.72060 |
| Vapour Pressure | 0.147mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | WEUAASLFNKTIIM-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(CCl)c(F)c(F)c1CCl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2903999090 |
|
~97%
1,4-bis(chlorom... CAS#:131803-37-7 |
| Literature: Brooke, Gerald M.; Mawson, Simon D. Journal of Fluorine Chemistry, 1990 , vol. 50, # 1 p. 101 - 109 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD03424467 |
| 1,4-bis(chloromethyl)-2,3,5,6-tetrafluorobenzene |