Metronidazole Acetate structure
|
Common Name | Metronidazole Acetate | ||
|---|---|---|---|---|
| CAS Number | 13182-82-6 | Molecular Weight | 213.19100 | |
| Density | 1.36g/cm3 | Boiling Point | 397.1ºC at 760 mmHg | |
| Molecular Formula | C8H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194ºC | |
| Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 397.1ºC at 760 mmHg |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19100 |
| Flash Point | 194ºC |
| Exact Mass | 213.07500 |
| PSA | 89.94000 |
| LogP | 1.18600 |
| Vapour Pressure | 1.62E-06mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | MQXDTGGRMOLAPU-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCn1c([N+](=O)[O-])cnc1C |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-acetoxy-2-(2-methyl-5-nitro-imidazol-1-yl)-ethane |
| 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl acetate |
| Metronidazole acetate |
| 1-(2-acetoxyethyl)-2-methyl-5-nitroimidazole |
| acetic acid 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl ester |
| 2-methyl-5-nitro-1h-imidazole-1-ethanol acetate(ester) |
| 2-(5-methyl-2-nitro-1H-imidazol-1-yl)ethyl acetate |