3-Isopropyl-d7-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide structure
|
Common Name | 3-Isopropyl-d7-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide | ||
|---|---|---|---|---|
| CAS Number | 131842-77-8 | Molecular Weight | 247.322 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 395.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H5D7N2O3S | Melting Point | 131-134°C | |
| MSDS | Chinese USA | Flash Point | 193.1±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 3-Isopropyl-d7-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxideBentazone-d7 is the deuterium labeled Bentazone[1]. Bentazone is a post-emergence herbicide used for selective control of broadleaf weeds and sedges in beans, rice, corn, peanuts, mint and others. It acts by interfering with photosynthesis[2]. |
| Name | 3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2,2-dioxo-1H-2λ6,1,3-benzothiadiazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Bentazone-d7 is the deuterium labeled Bentazone[1]. Bentazone is a post-emergence herbicide used for selective control of broadleaf weeds and sedges in beans, rice, corn, peanuts, mint and others. It acts by interfering with photosynthesis[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.7±25.0 °C at 760 mmHg |
| Melting Point | 131-134°C |
| Molecular Formula | C10H5D7N2O3S |
| Molecular Weight | 247.322 |
| Flash Point | 193.1±23.2 °C |
| Exact Mass | 247.100800 |
| PSA | 74.86000 |
| LogP | 2.80 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | ZOMSMJKLGFBRBS-QXMYYZBZSA-N |
| SMILES | CC(C)N1C(=O)c2ccccc2NS1(=O)=O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H319-H412 |
| Precautionary Statements | P273-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S24 |
| RIDADR | NONH for all modes of transport |
| Bentazon-d7 |
| 3-[(H)-2-Propanyl]-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide |
| 1H-2,1,3-Benzothiadiazin-4(3H)-one, 3-[1-(methyl-d)ethyl-1,2,2,2-d]-, 2,2-dioxide |