2-Isopropyl-5-nitropyridine structure
|
Common Name | 2-Isopropyl-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 131941-21-4 | Molecular Weight | 166.177 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 246.8±28.0 °C at 760 mmHg | |
| Molecular Formula | C8H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.1±24.0 °C | |
| Name | 5-nitro-2-propan-2-ylpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 246.8±28.0 °C at 760 mmHg |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.177 |
| Flash Point | 103.1±24.0 °C |
| Exact Mass | 166.074234 |
| PSA | 58.71000 |
| LogP | 1.90 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | NHGFJXPCQGXISU-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc([N+](=O)[O-])cn1 |
| HS Code | 2933399090 |
|---|
|
~36%
2-Isopropyl-5-n... CAS#:131941-21-4 |
| Literature: Tohda; Eiraku; Nakagawa; Usami; Ariga; Kawashima; Tani; Watanabe; Mori Bulletin of the Chemical Society of Japan, 1990 , vol. 63, # 10 p. 2820 - 2827 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine, 2-(1-methylethyl)-5-nitro- |
| 2-Isopropyl-5-nitropyridine |