1-Methyl-3,5-dinitro-2(1H)-pyridinone structure
|
Common Name | 1-Methyl-3,5-dinitro-2(1H)-pyridinone | ||
|---|---|---|---|---|
| CAS Number | 14150-94-8 | Molecular Weight | 199.121 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 289.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C6H5N3O5 | Melting Point | 174-178℃ | |
| MSDS | Chinese USA | Flash Point | 128.9±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-Methyl-3,5-Dinitro-1H-Pyridin-2-One |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 289.5±40.0 °C at 760 mmHg |
| Melting Point | 174-178℃ |
| Molecular Formula | C6H5N3O5 |
| Molecular Weight | 199.121 |
| Flash Point | 128.9±27.3 °C |
| Exact Mass | 199.022919 |
| PSA | 113.64000 |
| LogP | -1.21 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | QARVELJVEBLWGK-UHFFFAOYSA-N |
| SMILES | Cn1cc([N+](=O)[O-])cc([N+](=O)[O-])c1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-methyl-3,5-dinitropyridine-2(1H)-one |
| 1-Methyl-3,5-dinitro-2(1H)-pyridinone |
| 1-Methyl-3,5-dinitro-1H-pyridin-2-one |
| 1-methyl-3,5-dinitropyridin-2(1H)-one |
| 2(1H)-Pyridinone, 1-methyl-3,5-dinitro- |