Urea,N,N'-bis(2-nitrophenyl)- structure
|
Common Name | Urea,N,N'-bis(2-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 13201-86-0 | Molecular Weight | 302.24200 | |
| Density | 1.561g/cm3 | Boiling Point | 394.1ºC at 760mmHg | |
| Molecular Formula | C13H10N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.2ºC | |
| Name | 1,3-bis(2-nitrophenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.561g/cm3 |
|---|---|
| Boiling Point | 394.1ºC at 760mmHg |
| Molecular Formula | C13H10N4O5 |
| Molecular Weight | 302.24200 |
| Flash Point | 192.2ºC |
| Exact Mass | 302.06500 |
| PSA | 132.77000 |
| LogP | 4.33940 |
| Vapour Pressure | 2.03E-06mmHg at 25°C |
| Index of Refraction | 1.741 |
| InChIKey | QZLBMMPGNZXIAO-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])Nc1ccccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2'-dinitrocarbanilide |
| N,N'-bis(2-nitrophenyl)urea |
| 1,3-bis(o-nitrophenyl)urea |
| N-(2-nitrophenyl)-N'-(2-nitrophenyl)urea |
| Urea,N,N'-bis(2-nitrophenyl) |