Methyl 3-(2-Hydroxy-5-methoxyphenyl)-3-oxopropanoate structure
|
Common Name | Methyl 3-(2-Hydroxy-5-methoxyphenyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 132017-99-3 | Molecular Weight | 224.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O5 | Melting Point | 48-49ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 3-(2-Hydroxy-5-methoxyphenyl)-3-oxopropanoate |
|---|
| Melting Point | 48-49ºC |
|---|---|
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21000 |
| Exact Mass | 224.06800 |
| PSA | 72.83000 |
| LogP | 1.14660 |
| InChIKey | VCCBPXZEMNEBHR-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)c1cc(OC)ccc1O |
|
~%
Methyl 3-(2-Hyd... CAS#:132017-99-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 2 p. 798 - 806 |
|
Name: Ability to inhibit protein-tyrosine kinase activity of p56lck (isolated from bovine t...
Source: ChEMBL
Target: Tyrosine-protein kinase Lck
External Id: CHEMBL819754
|