Nitrogenistein structure
|
Common Name | Nitrogenistein | ||
|---|---|---|---|---|
| CAS Number | 39679-60-2 | Molecular Weight | 283.23600 | |
| Density | 1.494g/cm3 | Boiling Point | 530.8ºC at 760 mmHg | |
| Molecular Formula | C15H9NO5 | Melting Point | 320-325ºC | |
| MSDS | N/A | Flash Point | 274.8ºC | |
| Name | 6-hydroxy-2-(4-nitrophenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.494g/cm3 |
|---|---|
| Boiling Point | 530.8ºC at 760 mmHg |
| Melting Point | 320-325ºC |
| Molecular Formula | C15H9NO5 |
| Molecular Weight | 283.23600 |
| Flash Point | 274.8ºC |
| Exact Mass | 283.04800 |
| PSA | 96.26000 |
| LogP | 3.59700 |
| Index of Refraction | 1.692 |
| InChIKey | GKCGOBHFOXZJDK-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc([N+](=O)[O-])cc2)oc2ccc(O)cc12 |
|
Name: Cytotoxicity against human HT-29 cells after 6 days by MTT assay
Source: ChEMBL
Target: HT-29
External Id: CHEMBL938757
|
|
Name: Cytotoxicity against human MCF7 cells after 6 days by MTT assay
Source: ChEMBL
Target: MCF7
External Id: CHEMBL938756
|
|
Name: Cytotoxicity against human MALME-3M cells after 6 days by MTT assay
Source: ChEMBL
Target: Malme-3M
External Id: CHEMBL942437
|
|
Name: Cytotoxicity against human SK-MEL cells after 6 days by MTT assay
Source: ChEMBL
Target: SK-MEL
External Id: CHEMBL938758
|
|
Name: Cytotoxicity against human A549 cells after 6 days by MTT assay
Source: ChEMBL
Target: A549
External Id: CHEMBL938755
|
|
Name: Ability to inhibit protein-tyrosine kinase activity of p56lck (isolated from bovine t...
Source: ChEMBL
Target: Tyrosine-protein kinase Lck
External Id: CHEMBL819754
|
| 4'-Nitro-6-hydroxyflavone |
| 6-hydroxy-4'-nitroflavone |
| 6-Hydroxy-4'-nitro-flavon |
| Nitrogenistein |