Urea,N-(2-chlorophenyl)-N'-(3-nitrophenyl)- structure
|
Common Name | Urea,N-(2-chlorophenyl)-N'-(3-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 13208-67-8 | Molecular Weight | 291.69000 | |
| Density | 1.506g/cm3 | Boiling Point | 345.4ºC at 760 mmHg | |
| Molecular Formula | C13H10ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.7ºC | |
| Name | 1-(2-chlorophenyl)-3-(3-nitrophenyl)urea |
|---|
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 345.4ºC at 760 mmHg |
| Molecular Formula | C13H10ClN3O3 |
| Molecular Weight | 291.69000 |
| Flash Point | 162.7ºC |
| Exact Mass | 291.04100 |
| PSA | 86.95000 |
| LogP | 4.56140 |
| Vapour Pressure | 6.16E-05mmHg at 25°C |
| Index of Refraction | 1.72 |
| InChIKey | XHFVKTGURVHJEA-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)Nc1ccccc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |