6-(1-NAPHTHYL)-6-OXOHEXANOIC ACID structure
|
Common Name | 6-(1-NAPHTHYL)-6-OXOHEXANOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 132104-09-7 | Molecular Weight | 256.29600 | |
| Density | 1.188g/cm3 | Boiling Point | 479.1ºC at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.7ºC | |
| Name | 6-naphthalen-1-yl-6-oxohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760 mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 257.7ºC |
| Exact Mass | 256.11000 |
| PSA | 54.37000 |
| LogP | 3.66750 |
| Vapour Pressure | 5.45E-10mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | FFLVZZUBTNDFHA-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCC(=O)c1cccc2ccccc12 |
| HS Code | 2918300090 |
|---|
|
~%
6-(1-NAPHTHYL)-... CAS#:132104-09-7 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 3352,3354 |
|
~%
6-(1-NAPHTHYL)-... CAS#:132104-09-7 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 3352,3354 |
|
~%
6-(1-NAPHTHYL)-... CAS#:132104-09-7 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 3352,3354 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 6-[1]naphthyl-6-oxo-hexanoic acid |
| 6-(NAPHTHALEN-1-YL)-6-OXOHEXANOIC ACID |
| 5-<1-Naphthoyl>-valeriansaeure |
| 6-[1]Naphthyl-6-oxo-hexansaeure |