6-(4-BIPHENYL)-6-OXOHEXANOIC ACID
6-(4-BIPHENYL)-6-OXOHEXANOIC ACID structure
|
Common Name | 6-(4-BIPHENYL)-6-OXOHEXANOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 5366-53-0 | Molecular Weight | 282.33400 | |
| Density | 1.143g/cm3 | Boiling Point | 492.3ºC at 760 mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.6ºC | |
Summary: 6-Oxo-6-(4-phenylphenyl)hexanoic acid (6-(4-Phenylphenyl)-6-oxohexanoic acid), CAS number: 5366-53-0, molecular formula: C18H18O3, molecular weight: 282.33400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-oxo-6-(4-phenylphenyl)hexanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 492.3ºC at 760 mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 265.6ºC |
| Exact Mass | 282.12600 |
| PSA | 54.37000 |
| LogP | 4.18130 |
| Index of Refraction | 1.569 |
| InChIKey | OTUVUUGURDBVII-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCC(=O)c1ccc(-c2ccccc2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918300090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 6-oxo-6-(4-phenylphenyl)hexanoic acid? |
| A: LogP of 6-oxo-6-(4-phenylphenyl)hexanoic acid is 4.18130. |
| Q: What is the boiling point of 6-oxo-6-(4-phenylphenyl)hexanoic acid? |
| A: Boiling point of 6-oxo-6-(4-phenylphenyl)hexanoic acid is 492.3ºC at 760 mmHg. |
| Q: What is the SMILES notation of 6-oxo-6-(4-phenylphenyl)hexanoic acid? |
| A: SMILES notation of 6-oxo-6-(4-phenylphenyl)hexanoic acid is O=C(O)CCCCC(=O)c1ccc(-c2ccccc2)cc1. |
| Q: What is the English name of 6-oxo-6-(4-phenylphenyl)hexanoic acid? |
| A: The English name of 6-oxo-6-(4-phenylphenyl)hexanoic acid is 6-oxo-6-(4-phenylphenyl)hexanoic acid. |
| Q: What is the InChIKey of 6-oxo-6-(4-phenylphenyl)hexanoic acid? |
| A: InChIKey of 6-oxo-6-(4-phenylphenyl)hexanoic acid is OTUVUUGURDBVII-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 6-oxo-6-(4-phenylphenyl)hexanoic acid? |
| A: Polar surface area (PSA) of 6-oxo-6-(4-phenylphenyl)hexanoic acid is 54.37000. |
| Q: What is the molecular weight of 6-oxo-6-(4-phenylphenyl)hexanoic acid? |
| A: Molecular weight of 6-oxo-6-(4-phenylphenyl)hexanoic acid is 282.33400. |
| Q: What is the Chinese name of 5366-53-0? |
| A: Chinese name of 5366-53-0 is 5366-53-0. |
| Q: What is the molecular formula of 6-oxo-6-(4-phenylphenyl)hexanoic acid? |
| A: Molecular formula of 6-oxo-6-(4-phenylphenyl)hexanoic acid is C18H18O3. |
| Q: What is the CAS number of 6-oxo-6-(4-phenylphenyl)hexanoic acid? |
| A: CAS number of 6-oxo-6-(4-phenylphenyl)hexanoic acid is 5366-53-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |