6-(4-BIPHENYL)-6-OXOHEXANOIC ACID structure
|
Common Name | 6-(4-BIPHENYL)-6-OXOHEXANOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 5366-53-0 | Molecular Weight | 282.33400 | |
| Density | 1.143g/cm3 | Boiling Point | 492.3ºC at 760 mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.6ºC | |
| Name | 6-oxo-6-(4-phenylphenyl)hexanoic acid |
|---|
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 492.3ºC at 760 mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 265.6ºC |
| Exact Mass | 282.12600 |
| PSA | 54.37000 |
| LogP | 4.18130 |
| Index of Refraction | 1.569 |
| InChIKey | OTUVUUGURDBVII-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCC(=O)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |