1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)pentane structure
|
Common Name | 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)pentane | ||
|---|---|---|---|---|
| CAS Number | 132182-92-4 | Molecular Weight | 350.07700 | |
| Density | 1.67 | Boiling Point | 100ºC | |
| Molecular Formula | C7H3F13O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 7.172ºC | |
| Name | 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)pentane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.67 |
|---|---|
| Boiling Point | 100ºC |
| Molecular Formula | C7H3F13O |
| Molecular Weight | 350.07700 |
| Flash Point | 7.172ºC |
| Exact Mass | 349.99800 |
| PSA | 9.23000 |
| LogP | 4.32910 |
| Vapour Pressure | 97.543mmHg at 25°C |
| Index of Refraction | 1.274 |
| InChIKey | QKAGYSDHEJITFV-UHFFFAOYSA-N |
| SMILES | COC(F)(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
|
~%
1,1,1,2,2,3,4,5... CAS#:132182-92-4 |
| Literature: US6653512 B1, ; Page/Page column 13-14 ; |
|
~72%
1,1,1,2,2,3,4,5... CAS#:132182-92-4 |
| Literature: Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), , vol. 39, # 9.1. p. 1870 - 1876 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, , # 9 p. 2057 - 2063 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-trifluoromethyl-3-methoxyperfluoropentane |
| PC6474 |
| 1,1,1,2,3,4,4,5,5,5-DECAFLUORO-3-METHOXY-2-(TRIFLUOROMETHYL)PENTANE |
| 1,1,1,2,2,3,4,5,5,5-Decafluoro-3-methoxy-4-(trifluoromethyl)pentane |