Perfluoro(2-methyl-3-pentanone) structure
|
Common Name | Perfluoro(2-methyl-3-pentanone) | ||
|---|---|---|---|---|
| CAS Number | 756-13-8 | Molecular Weight | 316.044 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 60.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C6F12O | Melting Point | -108ºC | |
| MSDS | N/A | Flash Point | 9.1±20.1 °C | |
| Name | 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 60.0±35.0 °C at 760 mmHg |
| Melting Point | -108ºC |
| Molecular Formula | C6F12O |
| Molecular Weight | 316.044 |
| Flash Point | 9.1±20.1 °C |
| Exact Mass | 315.975739 |
| PSA | 17.07000 |
| LogP | 8.24 |
| Vapour Pressure | 196.4±0.1 mmHg at 25°C |
| Index of Refraction | 1.264 |
| InChIKey | RMLFHPWPTXWZNJ-UHFFFAOYSA-N |
| SMILES | O=C(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| Precursor 8 | |
|---|---|
| DownStream 7 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| perfluoro-2-methylpentan-3-one |
| 1,1,1,2,2,4,5,5,5-Nonafluoro-4-(trifluoromethyl)-3-pentanone |
| FXFFXXFXFFFVXFFXFFF |
| Heptafluoroisopropyl pentafluoroethyl ketone |
| 3-Pentanone, 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)- |
| Novec 1230 |
| perfluoroethyl isopropyl ketone |
| perfluoroethyl perfluoroisopropyl ketone |
| Perfluoro(2-methyl-3-pentanone) |