4-(4-chlorophenoxy)-2 chloro phenyl ethanone
Modify Date: 2024-02-28 19:22:44
4-(4-chlorophenoxy)-2 chloro phenyl ethanone structure
|
Common Name | 4-(4-chlorophenoxy)-2 chloro phenyl ethanone | ||
|---|---|---|---|---|
| CAS Number | 13221-80-2 | Molecular Weight | 281.13400 | |
| Density | 1.308 g/cm3 | Boiling Point | 401.5ºC at 760 mmHg | |
| Molecular Formula | C14H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.6ºC | |
| Name | 2-[2-chloro-4-(4-chlorophenoxy)phenyl]acetaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308 g/cm3 |
|---|---|
| Boiling Point | 401.5ºC at 760 mmHg |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.13400 |
| Flash Point | 163.6ºC |
| Exact Mass | 280.00600 |
| PSA | 26.30000 |
| LogP | 4.55380 |
| InChIKey | UASGQUAGMKEZDJ-UHFFFAOYSA-N |
| SMILES | O=C(CCl)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4'-Chlor-4-chloracetyl-biphenyl |