4-Methylbenzoic anhydride structure
|
Common Name | 4-Methylbenzoic anhydride | ||
|---|---|---|---|---|
| CAS Number | 13222-85-0 | Molecular Weight | 254.28100 | |
| Density | 1.159g/cm3 | Boiling Point | 411.6ºC at 760mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196ºC | |
| Name | 4-Methylbenzoic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 411.6ºC at 760mmHg |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 196ºC |
| Exact Mass | 254.09400 |
| PSA | 43.37000 |
| LogP | 3.30060 |
| Vapour Pressure | 5.5E-07mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | BJMLLSSSTGHJJE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)OC(=O)c2ccc(C)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (4-methylbenzoyl) 4-methylbenzoate |