N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2,2-trifluoroacetamide structure
|
Common Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2,2-trifluoroacetamide | ||
|---|---|---|---|---|
| CAS Number | 13230-71-2 | Molecular Weight | 277.24000 | |
| Density | 1.228g/cm3 | Boiling Point | 363.4ºC at 760 mmHg | |
| Molecular Formula | C12H14F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.6ºC | |
| Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2,2-trifluoroacetamide |
|---|
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 363.4ºC at 760 mmHg |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24000 |
| Flash Point | 173.6ºC |
| Exact Mass | 277.09300 |
| PSA | 51.05000 |
| LogP | 2.76510 |
| Vapour Pressure | 1.81E-05mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | RIULCRYOMGKNSV-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNC(=O)C(F)(F)F)cc1OC |
| HS Code | 2924299090 |
|---|
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |